C27H52N4O3 — CID 171116614
(2S)-4-(diaminomethylideneamino)-2-[[(Z)-docos-11-enoyl]amino]butanoic acid (PubChem CID 171116614) has the molecular formula C27H52N4O3 and a molecular weight of 480.74 g/mol. Its IUPAC name is (2S)-4-(diaminomethylideneamino)-2-[[(Z)-docos-11-enoyl]amino]butanoic acid.
| Compound Name | (2S)-4-(diaminomethylideneamino)-2-[[(Z)-docos-11-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 171116614 |
| Molecular Formula | C27H52N4O3 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | (2S)-4-(diaminomethylideneamino)-2-[[(Z)-docos-11-enoyl]amino]butanoic acid |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCCC(=O)N[C@@H](CCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H52N4O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(32)31-24(26(33)34)22-23-30-27(28)29/h11-12,24H,2-10,13-23H2,1H3,(H,31,32)(H,33,34)(H4,28,29,30)/b12-11-/t24-/m0/s1 |
| InChIKey | FRYBENCGZOWBAI-IPYQYMIDSA-N |
| XLogP | 5.82 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|