C13H14ClFN2 — CID 164614379
7-fluoro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride (PubChem CID 164614379) has the molecular formula C13H14ClFN2 and a molecular weight of 252.72 g/mol. Its IUPAC name is 7-fluoro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride.
| Compound Name | 7-fluoro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
|---|---|
| PubChem CID | 164614379 |
| Molecular Formula | C13H14ClFN2 |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 7-fluoro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
| SMILES | Cl.Nc1c2c(nc3ccc(F)cc13)CCCC2 |
| InChI | InChI=1S/C13H13FN2.ClH/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12;/h5-7H,1-4H2,(H2,15,16);1H |
| InChIKey | QBCQWDJADJKQSX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |