C38H35F3N4O3 — CID 164619175
4-[3-[7-methoxy-4-[2-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]quinazolin-6-yl]oxypropyl]morpholine (PubChem CID 164619175) has the molecular formula C38H35F3N4O3 and a molecular weight of 652.72 g/mol. Its IUPAC name is 4-[3-[7-methoxy-4-[2-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]quinazolin-6-yl]oxypropyl]morpholine.
| Compound Name | 4-[3-[7-methoxy-4-[2-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]quinazolin-6-yl]oxypropyl]morpholine |
|---|---|
| PubChem CID | 164619175 |
| Molecular Formula | C38H35F3N4O3 |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 4-[3-[7-methoxy-4-[2-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]quinazolin-6-yl]oxypropyl]morpholine |
| SMILES | COc1cc2ncnc(-c3c(-c4ccccc4)n(Cc4cccc(C(F)(F)F)c4)c4ccccc34)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C38H35F3N4O3/c1-46-33-23-31-30(22-34(33)48-18-8-15-44-16-19-47-20-17-44)36(43-25-42-31)35-29-13-5-6-14-32(29)45(37(35)27-10-3-2-4-11-27)24-26-9-7-12-28(21-26)38(39,40)41/h2-7,9-14,21-23,25H,8,15-20,24H2,1H3 |
| InChIKey | BMHBOGPKSBGNTE-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|