C31H32FN7O3 — CID 175560534
N-[3-[1-[(2-fluorophenyl)methyl]triazol-4-yl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 175560534) has the molecular formula C31H32FN7O3 and a molecular weight of 569.64 g/mol. Its IUPAC name is N-[3-[1-[(2-fluorophenyl)methyl]triazol-4-yl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-[3-[1-[(2-fluorophenyl)methyl]triazol-4-yl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 175560534 |
| Molecular Formula | C31H32FN7O3 |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | N-[3-[1-[(2-fluorophenyl)methyl]triazol-4-yl]phenyl]-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3cccc(-c4cn(Cc5ccccc5F)nn4)c3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C31H32FN7O3/c1-40-29-18-27-25(17-30(29)42-13-5-10-38-11-14-41-15-12-38)31(34-21-33-27)35-24-8-4-7-22(16-24)28-20-39(37-36-28)19-23-6-2-3-9-26(23)32/h2-4,6-9,16-18,20-21H,5,10-15,19H2,1H3,(H,33,34,35) |
| InChIKey | DNUORWHHSKHBSI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|