C26H30N6O2S2 — CID 164620447
N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-N-methylmethanesulfonamide (PubChem CID 164620447) has the molecular formula C26H30N6O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 164620447 |
| Molecular Formula | C26H30N6O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-N-methylmethanesulfonamide |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4scc(-c5cccc(N(C)S(C)(=O)=O)c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C26H30N6O2S2/c1-4-31-12-14-32(15-13-31)21-10-8-20(9-11-21)28-26-27-17-24-25(29-26)23(18-35-24)19-6-5-7-22(16-19)30(2)36(3,33)34/h5-11,16-18H,4,12-15H2,1-3H3,(H,27,28,29) |
| InChIKey | SEXHGQMRKQDDEO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|