About 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium
2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium (PubChem CID 164620764) has the molecular formula C27H27N2+
and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium.
Molecular Properties
| Compound Name | 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium |
| PubChem CID | 164620764 |
| Molecular Formula | C27H27N2+ |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium |
| SMILES | CCCCn1ccc2ccc(-c3ccc4c(c3)c3cc(C)ccc3c[n+]4C)cc21 |
| InChI | InChI=1S/C27H27N2/c1-4-5-13-29-14-12-20-8-9-22(17-27(20)29)21-10-11-26-25(16-21)24-15-19(2)6-7-23(24)18-28(26)3/h6-12,14-18H,4-5,13H2,1-3H3/q+1 |
| InChIKey | JZFMAPUZXJSVRA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium?
The IUPAC name of 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium (CID 164620764) is 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium.
What is the SMILES notation for 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium?
The canonical SMILES for 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium is CCCCn1ccc2ccc(-c3ccc4c(c3)c3cc(C)ccc3c[n+]4C)cc21.
What is the InChIKey of 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium?
The InChIKey is JZFMAPUZXJSVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27N2/c1-4-5-13-29-14-12-20-8-9-22(17-27(20)29)21-10-11-26-25(16-21)24-15-19(2)6-7-23(24)18-28(26)3/h6-12,14-18H,4-5,13H2,1-3H3/q+1.
What are the key properties of 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium?
2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium has a molecular weight of 379.53 g/mol, XLogP of 6.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butylindol-6-yl)-5,9-dimethylphenanthridin-5-ium is sourced from PubChem (CID 164620764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).