C28H20N6S2 — CID 164624541
5-(2-phenylphenyl)-3-[[5-(2-phenylphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole (PubChem CID 164624541) has the molecular formula C28H20N6S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 5-(2-phenylphenyl)-3-[[5-(2-phenylphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(2-phenylphenyl)-3-[[5-(2-phenylphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 164624541 |
| Molecular Formula | C28H20N6S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 5-(2-phenylphenyl)-3-[[5-(2-phenylphenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
| SMILES | c1ccc(-c2ccccc2-c2nc(SSc3n[nH]c(-c4ccccc4-c4ccccc4)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C28H20N6S2/c1-3-11-19(12-4-1)21-15-7-9-17-23(21)25-29-27(33-31-25)35-36-28-30-26(32-34-28)24-18-10-8-16-22(24)20-13-5-2-6-14-20/h1-18H,(H,29,31,33)(H,30,32,34) |
| InChIKey | GXWRXZRJMKEHCS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|