C22H24N4O3S2 — CID 164625393
N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]methanesulfonamide (PubChem CID 164625393) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 164625393 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1cnc(C(=O)N2CCc3c(-c4ccccc4)cccc32)s1 |
| InChI | InChI=1S/C22H24N4O3S2/c1-31(28,29)25-12-11-23-14-17-15-24-21(30-17)22(27)26-13-10-19-18(8-5-9-20(19)26)16-6-3-2-4-7-16/h2-9,15,23,25H,10-14H2,1H3 |
| InChIKey | GWRBJGHYJFJBQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|