C13H9BrN2O2S — CID 175219052
2-(4-bromo-2,3-dihydroindole-1-carbonyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 175219052) has the molecular formula C13H9BrN2O2S and a molecular weight of 337.20 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dihydroindole-1-carbonyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4-bromo-2,3-dihydroindole-1-carbonyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 175219052 |
| Molecular Formula | C13H9BrN2O2S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-(4-bromo-2,3-dihydroindole-1-carbonyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C(=O)N2CCc3c(Br)cccc32)s1 |
| InChI | InChI=1S/C13H9BrN2O2S/c14-10-2-1-3-11-9(10)4-5-16(11)13(18)12-15-6-8(7-17)19-12/h1-3,6-7H,4-5H2 |
| InChIKey | YKWMWPNSENAFSY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|