C23H23N5O2S — CID 164628186
[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1-methylindazol-4-yl)-2,3-dihydroindol-1-yl]methanone (PubChem CID 164628186) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1-methylindazol-4-yl)-2,3-dihydroindol-1-yl]methanone.
| Compound Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1-methylindazol-4-yl)-2,3-dihydroindol-1-yl]methanone |
|---|---|
| PubChem CID | 164628186 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1-methylindazol-4-yl)-2,3-dihydroindol-1-yl]methanone |
| SMILES | Cn1ncc2c(-c3cccc4c3CCN4C(=O)c3ncc(CNCCO)s3)cccc21 |
| InChI | InChI=1S/C23H23N5O2S/c1-27-20-6-2-5-17(19(20)14-26-27)16-4-3-7-21-18(16)8-10-28(21)23(30)22-25-13-15(31-22)12-24-9-11-29/h2-7,13-14,24,29H,8-12H2,1H3 |
| InChIKey | HAPRKXZLUPIOCR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|