C22H20N4O2S2 — CID 164617603
[4-(1,3-benzothiazol-5-yl)-2,3-dihydroindol-1-yl]-[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]methanone (PubChem CID 164617603) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-5-yl)-2,3-dihydroindol-1-yl]-[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]methanone.
| Compound Name | [4-(1,3-benzothiazol-5-yl)-2,3-dihydroindol-1-yl]-[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]methanone |
|---|---|
| PubChem CID | 164617603 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [4-(1,3-benzothiazol-5-yl)-2,3-dihydroindol-1-yl]-[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]methanone |
| SMILES | O=C(c1ncc(CNCCO)s1)N1CCc2c(-c3ccc4scnc4c3)cccc21 |
| InChI | InChI=1S/C22H20N4O2S2/c27-9-7-23-11-15-12-24-21(30-15)22(28)26-8-6-17-16(2-1-3-19(17)26)14-4-5-20-18(10-14)25-13-29-20/h1-5,10,12-13,23,27H,6-9,11H2 |
| InChIKey | IEXPPVZEWKILOD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|