C23H21N5O2S — CID 164628013
[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-quinoxalin-6-yl-2,3-dihydroindol-1-yl)methanone (PubChem CID 164628013) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-quinoxalin-6-yl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-quinoxalin-6-yl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 164628013 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-(4-quinoxalin-6-yl-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ncc(CNCCO)s1)N1CCc2c(-c3ccc4nccnc4c3)cccc21 |
| InChI | InChI=1S/C23H21N5O2S/c29-11-9-24-13-16-14-27-22(31-16)23(30)28-10-6-18-17(2-1-3-21(18)28)15-4-5-19-20(12-15)26-8-7-25-19/h1-5,7-8,12,14,24,29H,6,9-11,13H2 |
| InChIKey | UBULMGHHVFZNIA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|