C21H21F3N6O2S — CID 164626218
4-[[4-(propan-2-ylamino)-5-[[4-(trifluoromethyl)phenyl]methylideneamino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 164626218) has the molecular formula C21H21F3N6O2S and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-[[4-(propan-2-ylamino)-5-[[4-(trifluoromethyl)phenyl]methylideneamino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(propan-2-ylamino)-5-[[4-(trifluoromethyl)phenyl]methylideneamino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 164626218 |
| Molecular Formula | C21H21F3N6O2S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4-[[4-(propan-2-ylamino)-5-[[4-(trifluoromethyl)phenyl]methylideneamino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | CC(C)Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)ncc1/N=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N6O2S/c1-13(2)28-19-18(26-11-14-3-5-15(6-4-14)21(22,23)24)12-27-20(30-19)29-16-7-9-17(10-8-16)33(25,31)32/h3-13H,1-2H3,(H2,25,31,32)(H2,27,28,29,30)/b26-11+ |
| InChIKey | KEONYNSYGPYZLV-KBKYJPHKSA-N |
| XLogP | 4.46 |
| TPSA | 122.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|