C28H24N3O2S+ — CID 164627535
3-(8-methoxy-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one (PubChem CID 164627535) has the molecular formula C28H24N3O2S+ and a molecular weight of 466.59 g/mol. Its IUPAC name is 3-(8-methoxy-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one.
| Compound Name | 3-(8-methoxy-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one |
|---|---|
| PubChem CID | 164627535 |
| Molecular Formula | C28H24N3O2S+ |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 3-(8-methoxy-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one |
| SMILES | COc1ccc2c(c1)c1c[n+](C)ccc1n2CCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C28H24N3O2S/c1-29-15-13-23-21(18-29)20-17-19(33-2)11-12-22(20)30(23)16-14-28(32)31-24-7-3-5-9-26(24)34-27-10-6-4-8-25(27)31/h3-13,15,17-18H,14,16H2,1-2H3/q+1 |
| InChIKey | TYILUFWHLUDPEG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|