C27H21FN3OS+ — CID 164626952
3-(8-fluoro-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one (PubChem CID 164626952) has the molecular formula C27H21FN3OS+ and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-(8-fluoro-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one.
| Compound Name | 3-(8-fluoro-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one |
|---|---|
| PubChem CID | 164626952 |
| Molecular Formula | C27H21FN3OS+ |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-(8-fluoro-2-methylpyrido[4,3-b]indol-2-ium-5-yl)-1-phenothiazin-10-ylpropan-1-one |
| SMILES | C[n+]1ccc2c(c1)c1cc(F)ccc1n2CCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C27H21FN3OS/c1-29-14-12-22-20(17-29)19-16-18(28)10-11-21(19)30(22)15-13-27(32)31-23-6-2-4-8-25(23)33-26-9-5-3-7-24(26)31/h2-12,14,16-17H,13,15H2,1H3/q+1 |
| InChIKey | FESXNYAPGUCZIQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|