C17H23N5O — CID 164636865
1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-[(1S,2R)-2-phenylcyclohexyl]urea (PubChem CID 164636865) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-[(1S,2R)-2-phenylcyclohexyl]urea.
| Compound Name | 1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-[(1S,2R)-2-phenylcyclohexyl]urea |
|---|---|
| PubChem CID | 164636865 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-[(1S,2R)-2-phenylcyclohexyl]urea |
| SMILES | Cc1nc(NC(=O)N[C@H]2CCCC[C@@H]2c2ccccc2)nn1C |
| InChI | InChI=1S/C17H23N5O/c1-12-18-16(21-22(12)2)20-17(23)19-15-11-7-6-10-14(15)13-8-4-3-5-9-13/h3-5,8-9,14-15H,6-7,10-11H2,1-2H3,(H2,19,20,21,23)/t14-,15+/m1/s1 |
| InChIKey | KXPGAUJKQDUPTQ-CABCVRRESA-N |
| XLogP | 2.97 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |