C17H21N3O3 — CID 164638098
(3S)-N-(3-oxo-1,2-dihydroisoindol-4-yl)-3-(2-oxopiperidin-1-yl)butanamide (PubChem CID 164638098) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (3S)-N-(3-oxo-1,2-dihydroisoindol-4-yl)-3-(2-oxopiperidin-1-yl)butanamide.
| Compound Name | (3S)-N-(3-oxo-1,2-dihydroisoindol-4-yl)-3-(2-oxopiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 164638098 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (3S)-N-(3-oxo-1,2-dihydroisoindol-4-yl)-3-(2-oxopiperidin-1-yl)butanamide |
| SMILES | C[C@@H](CC(=O)Nc1cccc2c1C(=O)NC2)N1CCCCC1=O |
| InChI | InChI=1S/C17H21N3O3/c1-11(20-8-3-2-7-15(20)22)9-14(21)19-13-6-4-5-12-10-18-17(23)16(12)13/h4-6,11H,2-3,7-10H2,1H3,(H,18,23)(H,19,21)/t11-/m0/s1 |
| InChIKey | RVOSBPDPDJGTJM-NSHDSACASA-N |
| XLogP | 1.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |