C16H17N3O2 — CID 164638238
(5S)-1-cyclopropyl-5-methyl-3-(5-methyl-1H-indol-6-yl)imidazolidine-2,4-dione (PubChem CID 164638238) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is (5S)-1-cyclopropyl-5-methyl-3-(5-methyl-1H-indol-6-yl)imidazolidine-2,4-dione.
| Compound Name | (5S)-1-cyclopropyl-5-methyl-3-(5-methyl-1H-indol-6-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164638238 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (5S)-1-cyclopropyl-5-methyl-3-(5-methyl-1H-indol-6-yl)imidazolidine-2,4-dione |
| SMILES | Cc1cc2cc[nH]c2cc1N1C(=O)[C@H](C)N(C2CC2)C1=O |
| InChI | InChI=1S/C16H17N3O2/c1-9-7-11-5-6-17-13(11)8-14(9)19-15(20)10(2)18(16(19)21)12-3-4-12/h5-8,10,12,17H,3-4H2,1-2H3/t10-/m0/s1 |
| InChIKey | WYHPSBUTOGDSNJ-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|