C19H15F3N2O4 — CID 69367085
2-[6-methyl-2-oxo-4-(trifluoromethyl)-1H-quinolin-7-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 69367085) has the molecular formula C19H15F3N2O4 and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-[6-methyl-2-oxo-4-(trifluoromethyl)-1H-quinolin-7-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[6-methyl-2-oxo-4-(trifluoromethyl)-1H-quinolin-7-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 69367085 |
| Molecular Formula | C19H15F3N2O4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[6-methyl-2-oxo-4-(trifluoromethyl)-1H-quinolin-7-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1cc2c(C(F)(F)F)cc(=O)[nH]c2cc1N1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C19H15F3N2O4/c1-7-4-8-9(19(20,21)22)5-14(25)23-10(8)6-11(7)24-17(26)15-12-2-3-13(28-12)16(15)18(24)27/h4-6,12-13,15-16H,2-3H2,1H3,(H,23,25) |
| InChIKey | IIEBGIWTZMADDS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|