C14H9F6IN2O2 — CID 142046868
(2R)-2-iodo-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one (PubChem CID 142046868) has the molecular formula C14H9F6IN2O2 and a molecular weight of 478.13 g/mol. Its IUPAC name is (2R)-2-iodo-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one.
| Compound Name | (2R)-2-iodo-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one |
|---|---|
| PubChem CID | 142046868 |
| Molecular Formula | C14H9F6IN2O2 |
| Molecular Weight | 478.13 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | (2R)-2-iodo-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one |
| SMILES | O=c1cc(C(F)(F)F)c2cc3c(cc2[nH]1)OC[C@@H](I)N3CC(F)(F)F |
| InChI | InChI=1S/C14H9F6IN2O2/c15-13(16,17)5-23-9-1-6-7(14(18,19)20)2-12(24)22-8(6)3-10(9)25-4-11(23)21/h1-3,11H,4-5H2,(H,22,24)/t11-/m0/s1 |
| InChIKey | OMYMOTIEOWQQJZ-NSHDSACASA-N |
| XLogP | 4.07 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|