C17H17F6N3O2 — CID 142168992
(2R,3S)-6-amino-3-ethyl-2-methyl-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazin-7-one (PubChem CID 142168992) has the molecular formula C17H17F6N3O2 and a molecular weight of 409.33 g/mol. Its IUPAC name is (2R,3S)-6-amino-3-ethyl-2-methyl-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazin-7-one.
| Compound Name | (2R,3S)-6-amino-3-ethyl-2-methyl-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazin-7-one |
|---|---|
| PubChem CID | 142168992 |
| Molecular Formula | C17H17F6N3O2 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (2R,3S)-6-amino-3-ethyl-2-methyl-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazin-7-one |
| SMILES | CC[C@@H]1Oc2cc3c(cc2N(CC(F)(F)F)[C@@H]1C)c(C(F)(F)F)cc(=O)n3N |
| InChI | InChI=1S/C17H17F6N3O2/c1-3-13-8(2)25(7-16(18,19)20)12-4-9-10(17(21,22)23)5-15(27)26(24)11(9)6-14(12)28-13/h4-6,8,13H,3,7,24H2,1-2H3/t8-,13+/m1/s1 |
| InChIKey | QOFYARBEWLWIFQ-OQPBUACISA-N |
| XLogP | 3.66 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |