C17H14F8N2O — CID 15980299
1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-9-(trifluoromethyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one (PubChem CID 15980299) has the molecular formula C17H14F8N2O and a molecular weight of 414.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-9-(trifluoromethyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one.
| Compound Name | 1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-9-(trifluoromethyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one |
|---|---|
| PubChem CID | 15980299 |
| Molecular Formula | C17H14F8N2O |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1,2-dimethyl-3-(2,2,3,3,3-pentafluoropropyl)-9-(trifluoromethyl)-2,6-dihydro-1H-pyrrolo[3,2-f]quinolin-7-one |
| SMILES | CC1c2c(ccc3[nH]c(=O)cc(C(F)(F)F)c23)N(CC(F)(F)C(F)(F)F)C1C |
| InChI | InChI=1S/C17H14F8N2O/c1-7-8(2)27(6-15(18,19)17(23,24)25)11-4-3-10-14(13(7)11)9(16(20,21)22)5-12(28)26-10/h3-5,7-8H,6H2,1-2H3,(H,26,28) |
| InChIKey | YJNPFHKQBJIWMF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|