C16H13F3N4O3 — CID 51422474
(3aR,4S,7R,7aS)-2-[4-methyl-6-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 51422474) has the molecular formula C16H13F3N4O3 and a molecular weight of 366.30 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-[4-methyl-6-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-[4-methyl-6-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 51422474 |
| Molecular Formula | C16H13F3N4O3 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-[4-methyl-6-(trifluoromethyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)nc2[nH]nc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3CC[C@@H]4O3)c12 |
| InChI | InChI=1S/C16H13F3N4O3/c1-5-4-8(16(17,18)19)20-12-9(5)13(22-21-12)23-14(24)10-6-2-3-7(26-6)11(10)15(23)25/h4,6-7,10-11H,2-3H2,1H3,(H,20,21,22)/t6-,7+,10-,11+ |
| InChIKey | KQDWBQAGZRGCRP-BJPCUFFRSA-N |
| XLogP | 1.95 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|