C15H12F3N3O2S — CID 26433456
(7S)-12-methyl-14-(trifluoromethyl)-17-thia-3,9,15-triazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-2,8-dione (PubChem CID 26433456) has the molecular formula C15H12F3N3O2S and a molecular weight of 355.34 g/mol. Its IUPAC name is (7S)-12-methyl-14-(trifluoromethyl)-17-thia-3,9,15-triazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-2,8-dione.
| Compound Name | (7S)-12-methyl-14-(trifluoromethyl)-17-thia-3,9,15-triazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-2,8-dione |
|---|---|
| PubChem CID | 26433456 |
| Molecular Formula | C15H12F3N3O2S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (7S)-12-methyl-14-(trifluoromethyl)-17-thia-3,9,15-triazatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-2,8-dione |
| SMILES | Cc1cc(C(F)(F)F)nc2sc3c(c12)NC(=O)[C@@H]1CCCN1C3=O |
| InChI | InChI=1S/C15H12F3N3O2S/c1-6-5-8(15(16,17)18)19-13-9(6)10-11(24-13)14(23)21-4-2-3-7(21)12(22)20-10/h5,7H,2-4H2,1H3,(H,20,22)/t7-/m0/s1 |
| InChIKey | WBCWFXXKSDDBFS-ZETCQYMHSA-N |
| XLogP | 3.18 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |