C17H18N4O2S — CID 71834939
6-methyl-12-thia-6,10,15,21-tetrazapentacyclo[11.8.0.02,11.04,9.015,19]henicosa-1(13),2(11),3,9-tetraene-14,20-dione (PubChem CID 71834939) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-methyl-12-thia-6,10,15,21-tetrazapentacyclo[11.8.0.02,11.04,9.015,19]henicosa-1(13),2(11),3,9-tetraene-14,20-dione.
| Compound Name | 6-methyl-12-thia-6,10,15,21-tetrazapentacyclo[11.8.0.02,11.04,9.015,19]henicosa-1(13),2(11),3,9-tetraene-14,20-dione |
|---|---|
| PubChem CID | 71834939 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-methyl-12-thia-6,10,15,21-tetrazapentacyclo[11.8.0.02,11.04,9.015,19]henicosa-1(13),2(11),3,9-tetraene-14,20-dione |
| SMILES | CN1CCc2nc3sc4c(c3cc2C1)NC(=O)C1CCCN1C4=O |
| InChI | InChI=1S/C17H18N4O2S/c1-20-6-4-11-9(8-20)7-10-13-14(24-16(10)18-11)17(23)21-5-2-3-12(21)15(22)19-13/h7,12H,2-6,8H2,1H3,(H,19,22) |
| InChIKey | FFCQIZCDHLZHHI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |