C13H10N4O2S2 — CID 57149708
(7R)-12-amino-2,8-dioxo-14,16-dithia-3,9-diazatetracyclo[8.6.0.03,7.011,15]hexadeca-1(10),11(15),12-triene-13-carbonitrile (PubChem CID 57149708) has the molecular formula C13H10N4O2S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (7R)-12-amino-2,8-dioxo-14,16-dithia-3,9-diazatetracyclo[8.6.0.03,7.011,15]hexadeca-1(10),11(15),12-triene-13-carbonitrile.
| Compound Name | (7R)-12-amino-2,8-dioxo-14,16-dithia-3,9-diazatetracyclo[8.6.0.03,7.011,15]hexadeca-1(10),11(15),12-triene-13-carbonitrile |
|---|---|
| PubChem CID | 57149708 |
| Molecular Formula | C13H10N4O2S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (7R)-12-amino-2,8-dioxo-14,16-dithia-3,9-diazatetracyclo[8.6.0.03,7.011,15]hexadeca-1(10),11(15),12-triene-13-carbonitrile |
| SMILES | N#Cc1sc2sc3c(c2c1N)NC(=O)[C@H]1CCCN1C3=O |
| InChI | InChI=1S/C13H10N4O2S2/c14-4-6-8(15)7-9-10(21-13(7)20-6)12(19)17-3-1-2-5(17)11(18)16-9/h5H,1-3,15H2,(H,16,18)/t5-/m1/s1 |
| InChIKey | QBLNQWIKQCLXIY-RXMQYKEDSA-N |
| XLogP | 1.97 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |