C20H14F3N3O2 — CID 102345440
(7S)-13-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione (PubChem CID 102345440) has the molecular formula C20H14F3N3O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is (7S)-13-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione.
| Compound Name | (7S)-13-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione |
|---|---|
| PubChem CID | 102345440 |
| Molecular Formula | C20H14F3N3O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (7S)-13-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione |
| SMILES | O=C1Nc2ncc(C#Cc3ccc(C(F)(F)F)cc3)cc2C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C20H14F3N3O2/c21-20(22,23)14-7-5-12(6-8-14)3-4-13-10-15-17(24-11-13)25-18(27)16-2-1-9-26(16)19(15)28/h5-8,10-11,16H,1-2,9H2,(H,24,25,27)/t16-/m0/s1 |
| InChIKey | JUBLBXBWNGSIDT-INIZCTEOSA-N |
| XLogP | 3.06 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|