C19H25FN4O3 — CID 164641217
(5S)-2-[(3-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-5-carboxamide (PubChem CID 164641217) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is (5S)-2-[(3-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-5-carboxamide.
| Compound Name | (5S)-2-[(3-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-5-carboxamide |
|---|---|
| PubChem CID | 164641217 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (5S)-2-[(3-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-5-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CCCCc2nn(Cc3cccc(F)c3)c(=O)n21 |
| InChI | InChI=1S/C19H25FN4O3/c1-27-11-5-10-21-18(25)16-8-2-3-9-17-22-23(19(26)24(16)17)13-14-6-4-7-15(20)12-14/h4,6-7,12,16H,2-3,5,8-11,13H2,1H3,(H,21,25)/t16-/m0/s1 |
| InChIKey | MHLWGIICSFJJRY-INIZCTEOSA-N |
| XLogP | 1.65 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|