C12H22ClN — CID 164650333
N-[1-(1-chlorocyclopropyl)ethyl]-3,3-dimethylcyclopentan-1-amine (PubChem CID 164650333) has the molecular formula C12H22ClN and a molecular weight of 215.77 g/mol. Its IUPAC name is N-[1-(1-chlorocyclopropyl)ethyl]-3,3-dimethylcyclopentan-1-amine.
| Compound Name | N-[1-(1-chlorocyclopropyl)ethyl]-3,3-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 164650333 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[1-(1-chlorocyclopropyl)ethyl]-3,3-dimethylcyclopentan-1-amine |
| SMILES | CC(NC1CCC(C)(C)C1)C1(Cl)CC1 |
| InChI | InChI=1S/C12H22ClN/c1-9(12(13)6-7-12)14-10-4-5-11(2,3)8-10/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | ITCVFIFYTRKJBP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|