C12H11FN2 — CID 164652234
2-(3,5-dimethylphenyl)-4-fluoropyrimidine (PubChem CID 164652234) has the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4-fluoropyrimidine.
| Compound Name | 2-(3,5-dimethylphenyl)-4-fluoropyrimidine |
|---|---|
| PubChem CID | 164652234 |
| Molecular Formula | C12H11FN2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4-fluoropyrimidine |
| SMILES | Cc1cc(C)cc(-c2nccc(F)n2)c1 |
| InChI | InChI=1S/C12H11FN2/c1-8-5-9(2)7-10(6-8)12-14-4-3-11(13)15-12/h3-7H,1-2H3 |
| InChIKey | ZQEFAPWNLSZMHN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |