C23H20FN — CID 171576459
1-(3,5-dimethylphenyl)-6-fluoro-8,9-dimethylbenzo[h]isoquinoline (PubChem CID 171576459) has the molecular formula C23H20FN and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-6-fluoro-8,9-dimethylbenzo[h]isoquinoline.
| Compound Name | 1-(3,5-dimethylphenyl)-6-fluoro-8,9-dimethylbenzo[h]isoquinoline |
|---|---|
| PubChem CID | 171576459 |
| Molecular Formula | C23H20FN |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-6-fluoro-8,9-dimethylbenzo[h]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3cc(F)c4cc(C)c(C)cc4c23)c1 |
| InChI | InChI=1S/C23H20FN/c1-13-7-14(2)9-18(8-13)23-22-17(5-6-25-23)12-21(24)19-10-15(3)16(4)11-20(19)22/h5-12H,1-4H3 |
| InChIKey | CEMKFTATNMIVLA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|