C22H34N6O3 — CID 164664421
2-[4-[[(5S)-3-[4-(4-methylpiperazine-1-carboximidoyl)phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-yl]acetic acid (PubChem CID 164664421) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[4-[[(5S)-3-[4-(4-methylpiperazine-1-carboximidoyl)phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[(5S)-3-[4-(4-methylpiperazine-1-carboximidoyl)phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 164664421 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2-[4-[[(5S)-3-[4-(4-methylpiperazine-1-carboximidoyl)phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(C2C[C@@H](CN3CCN(CC(=O)O)CC3)ON2)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H34N6O3/c1-25-6-12-28(13-7-25)22(23)18-4-2-17(3-5-18)20-14-19(31-24-20)15-26-8-10-27(11-9-26)16-21(29)30/h2-5,19-20,23-24H,6-16H2,1H3,(H,29,30)/b23-22-/t19-,20?/m0/s1 |
| InChIKey | WKQHOTOIYQFAAO-INPISIHKSA-N |
| XLogP | 0.30 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|