C22H36N6O3+2 — CID 164664417
2-[4-[[(5S)-3-[4-[amino-(4-methylpiperazin-1-ium-1-ylidene)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-ium-1-yl]acetic acid (PubChem CID 164664417) has the molecular formula C22H36N6O3+2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-[4-[[(5S)-3-[4-[amino-(4-methylpiperazin-1-ium-1-ylidene)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[4-[[(5S)-3-[4-[amino-(4-methylpiperazin-1-ium-1-ylidene)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 164664417 |
| Molecular Formula | C22H36N6O3+2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 2-[4-[[(5S)-3-[4-[amino-(4-methylpiperazin-1-ium-1-ylidene)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperazin-1-ium-1-yl]acetic acid |
| SMILES | CN1CC[N+](=C(N)c2ccc(C3C[C@@H](CN4CC[NH+](CC(=O)O)CC4)ON3)cc2)CC1 |
| InChI | InChI=1S/C22H34N6O3/c1-25-6-12-28(13-7-25)22(23)18-4-2-17(3-5-18)20-14-19(31-24-20)15-26-8-10-27(11-9-26)16-21(29)30/h2-5,19-20,23-24H,6-16H2,1H3,(H,29,30)/p+2/t19-,20?/m0/s1 |
| InChIKey | WKQHOTOIYQFAAO-XJDOXCRVSA-P |
| XLogP | -2.03 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|