C26H33N5O3 — CID 18407548
2-[4-[[3-[4-[N-methyl-N-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid (PubChem CID 18407548) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[4-[[3-[4-[N-methyl-N-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[N-methyl-N-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18407548 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-[4-[[3-[4-[N-methyl-N-(2-phenylethyl)carbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(CN3CCN(CC(=O)O)CC3)C2)cc1)N(C)CCc1ccccc1 |
| InChI | InChI=1S/C26H33N5O3/c1-29(12-11-20-5-3-2-4-6-20)26(27)22-9-7-21(8-10-22)24-17-23(34-28-24)18-30-13-15-31(16-14-30)19-25(32)33/h2-10,23,27H,11-19H2,1H3,(H,32,33)/b27-26- |
| InChIKey | VDLZEHSHHCXWSC-RQZHXJHFSA-N |
| XLogP | 2.38 |
| TPSA | 92.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|