C21H25NO3S — CID 164667264
1-[(4aS,8aS,9aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,4a,8a,9,9a-octahydrobenzo[f]isoindol-4-yl]ethanone (PubChem CID 164667264) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 1-[(4aS,8aS,9aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,4a,8a,9,9a-octahydrobenzo[f]isoindol-4-yl]ethanone.
| Compound Name | 1-[(4aS,8aS,9aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,4a,8a,9,9a-octahydrobenzo[f]isoindol-4-yl]ethanone |
|---|---|
| PubChem CID | 164667264 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(4aS,8aS,9aR)-2-(4-methylphenyl)sulfonyl-1,3,3a,4,4a,8a,9,9a-octahydrobenzo[f]isoindol-4-yl]ethanone |
| SMILES | CC(=O)C1C2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2C[C@H]2C=CC=C[C@H]12 |
| InChI | InChI=1S/C21H25NO3S/c1-14-7-9-18(10-8-14)26(24,25)22-12-17-11-16-5-3-4-6-19(16)21(15(2)23)20(17)13-22/h3-10,16-17,19-21H,11-13H2,1-2H3/t16-,17+,19+,20?,21?/m1/s1 |
| InChIKey | JSWIAYUDFZOKGM-XSLXLRSOSA-N |
| XLogP | 3.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |