C19H19NO5S — CID 164667766
methyl (E)-3-(furan-2-yl)-2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate (PubChem CID 164667766) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is methyl (E)-3-(furan-2-yl)-2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate.
| Compound Name | methyl (E)-3-(furan-2-yl)-2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 164667766 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | methyl (E)-3-(furan-2-yl)-2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate |
| SMILES | C#CCN(C/C(=C\c1ccco1)C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-4-11-20(26(22,23)18-9-7-15(2)8-10-18)14-16(19(21)24-3)13-17-6-5-12-25-17/h1,5-10,12-13H,11,14H2,2-3H3/b16-13+ |
| InChIKey | OERORTLDEIOQPD-DTQAZKPQSA-N |
| XLogP | 2.47 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|