C13H16N2O4 — CID 164670763
[(Z)-(2-nitro-1-phenylethylidene)amino] 2,2-dimethylpropanoate (PubChem CID 164670763) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [(Z)-(2-nitro-1-phenylethylidene)amino] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-(2-nitro-1-phenylethylidene)amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 164670763 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [(Z)-(2-nitro-1-phenylethylidene)amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O/N=C(\C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C13H16N2O4/c1-13(2,3)12(16)19-14-11(9-15(17)18)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3/b14-11+ |
| InChIKey | MDPKHEUFQQLQPJ-SDNWHVSQSA-N |
| XLogP | 2.26 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|