C14H25NO2 — CID 164672103
N-[(3R,4S)-4-prop-2-enoxynon-1-en-3-yl]acetamide (PubChem CID 164672103) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(3R,4S)-4-prop-2-enoxynon-1-en-3-yl]acetamide.
| Compound Name | N-[(3R,4S)-4-prop-2-enoxynon-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 164672103 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[(3R,4S)-4-prop-2-enoxynon-1-en-3-yl]acetamide |
| SMILES | C=CCO[C@@H](CCCCC)[C@@H](C=C)NC(C)=O |
| InChI | InChI=1S/C14H25NO2/c1-5-8-9-10-14(17-11-6-2)13(7-3)15-12(4)16/h6-7,13-14H,2-3,5,8-11H2,1,4H3,(H,15,16)/t13-,14+/m1/s1 |
| InChIKey | CPLUNLUBQHPCAK-KGLIPLIRSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|