C13H25NO3 — CID 164672104
N-[(3R,4S)-4-(2-hydroxyethoxy)non-1-en-3-yl]acetamide (PubChem CID 164672104) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(3R,4S)-4-(2-hydroxyethoxy)non-1-en-3-yl]acetamide.
| Compound Name | N-[(3R,4S)-4-(2-hydroxyethoxy)non-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 164672104 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-[(3R,4S)-4-(2-hydroxyethoxy)non-1-en-3-yl]acetamide |
| SMILES | C=C[C@@H](NC(C)=O)[C@H](CCCCC)OCCO |
| InChI | InChI=1S/C13H25NO3/c1-4-6-7-8-13(17-10-9-15)12(5-2)14-11(3)16/h5,12-13,15H,2,4,6-10H2,1,3H3,(H,14,16)/t12-,13+/m1/s1 |
| InChIKey | YTELQRXBUFSUSU-OLZOCXBDSA-N |
| XLogP | 1.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|