C42H40Si — CID 164672219
[(13R,17S)-10,20-diphenyl-15-hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,20,22,24,26-decaenyl]-trimethylsilane (PubChem CID 164672219) has the molecular formula C42H40Si and a molecular weight of 572.87 g/mol. Its IUPAC name is [(13R,17S)-10,20-diphenyl-15-hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,20,22,24,26-decaenyl]-trimethylsilane.
| Compound Name | [(13R,17S)-10,20-diphenyl-15-hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,20,22,24,26-decaenyl]-trimethylsilane |
|---|---|
| PubChem CID | 164672219 |
| Molecular Formula | C42H40Si |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | [(13R,17S)-10,20-diphenyl-15-hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,20,22,24,26-decaenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1C[C@H]2Cc3c(-c4ccccc4)cc4ccccc4c3-c3c(c(-c4ccccc4)cc4ccccc34)C[C@H]2C1 |
| InChI | InChI=1S/C42H40Si/c1-43(2,3)34-22-32-26-39-37(28-14-6-4-7-15-28)24-30-18-10-12-20-35(30)41(39)42-36-21-13-11-19-31(36)25-38(29-16-8-5-9-17-29)40(42)27-33(32)23-34/h4-21,24-25,32-34H,22-23,26-27H2,1-3H3/t32-,33+,34? |
| InChIKey | RJBMLEKEFRFZDG-CRBFYLPFSA-N |
| XLogP | 11.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|