C16H13BrF3NO2 — CID 164675539
benzyl (2R)-2-(4-bromoanilino)-3,3,3-trifluoropropanoate (PubChem CID 164675539) has the molecular formula C16H13BrF3NO2 and a molecular weight of 388.18 g/mol. Its IUPAC name is benzyl (2R)-2-(4-bromoanilino)-3,3,3-trifluoropropanoate.
| Compound Name | benzyl (2R)-2-(4-bromoanilino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 164675539 |
| Molecular Formula | C16H13BrF3NO2 |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | benzyl (2R)-2-(4-bromoanilino)-3,3,3-trifluoropropanoate |
| SMILES | O=C(OCc1ccccc1)[C@@H](Nc1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H13BrF3NO2/c17-12-6-8-13(9-7-12)21-14(16(18,19)20)15(22)23-10-11-4-2-1-3-5-11/h1-9,14,21H,10H2/t14-/m1/s1 |
| InChIKey | WIZJFVQYAQKBDP-CQSZACIVSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |