C20H22F3NO2 — CID 164673379
benzyl (2R)-2-(4-tert-butylanilino)-3,3,3-trifluoropropanoate (PubChem CID 164673379) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is benzyl (2R)-2-(4-tert-butylanilino)-3,3,3-trifluoropropanoate.
| Compound Name | benzyl (2R)-2-(4-tert-butylanilino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 164673379 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | benzyl (2R)-2-(4-tert-butylanilino)-3,3,3-trifluoropropanoate |
| SMILES | CC(C)(C)c1ccc(N[C@H](C(=O)OCc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO2/c1-19(2,3)15-9-11-16(12-10-15)24-17(20(21,22)23)18(25)26-13-14-7-5-4-6-8-14/h4-12,17,24H,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | PTUBGIOPRMYMIR-QGZVFWFLSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |