C20H16F3NO2 — CID 164675540
benzyl (2R)-3,3,3-trifluoro-2-(naphthalen-2-ylamino)propanoate (PubChem CID 164675540) has the molecular formula C20H16F3NO2 and a molecular weight of 359.35 g/mol. Its IUPAC name is benzyl (2R)-3,3,3-trifluoro-2-(naphthalen-2-ylamino)propanoate.
| Compound Name | benzyl (2R)-3,3,3-trifluoro-2-(naphthalen-2-ylamino)propanoate |
|---|---|
| PubChem CID | 164675540 |
| Molecular Formula | C20H16F3NO2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | benzyl (2R)-3,3,3-trifluoro-2-(naphthalen-2-ylamino)propanoate |
| SMILES | O=C(OCc1ccccc1)[C@@H](Nc1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO2/c21-20(22,23)18(19(25)26-13-14-6-2-1-3-7-14)24-17-11-10-15-8-4-5-9-16(15)12-17/h1-12,18,24H,13H2/t18-/m1/s1 |
| InChIKey | KSXGNAMDXXJPGL-GOSISDBHSA-N |
| XLogP | 4.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |