C25H25F3N2O2 — CID 13080356
(3-anilinophenyl)methyl 3-methyl-2-[4-(trifluoromethyl)anilino]butanoate (PubChem CID 13080356) has the molecular formula C25H25F3N2O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is (3-anilinophenyl)methyl 3-methyl-2-[4-(trifluoromethyl)anilino]butanoate.
| Compound Name | (3-anilinophenyl)methyl 3-methyl-2-[4-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 13080356 |
| Molecular Formula | C25H25F3N2O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (3-anilinophenyl)methyl 3-methyl-2-[4-(trifluoromethyl)anilino]butanoate |
| SMILES | CC(C)C(Nc1ccc(C(F)(F)F)cc1)C(=O)OCc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C25H25F3N2O2/c1-17(2)23(30-21-13-11-19(12-14-21)25(26,27)28)24(31)32-16-18-7-6-10-22(15-18)29-20-8-4-3-5-9-20/h3-15,17,23,29-30H,16H2,1-2H3 |
| InChIKey | BHQQPSGPOKWCCR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |