C18H18F3NO2 — CID 164675806
(2,5-dimethylphenyl)methyl (2S)-2-anilino-3,3,3-trifluoropropanoate (PubChem CID 164675806) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl (2S)-2-anilino-3,3,3-trifluoropropanoate.
| Compound Name | (2,5-dimethylphenyl)methyl (2S)-2-anilino-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 164675806 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2,5-dimethylphenyl)methyl (2S)-2-anilino-3,3,3-trifluoropropanoate |
| SMILES | Cc1ccc(C)c(COC(=O)[C@H](Nc2ccccc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO2/c1-12-8-9-13(2)14(10-12)11-24-17(23)16(18(19,20)21)22-15-6-4-3-5-7-15/h3-10,16,22H,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | GPOQXSMFFZHGJF-INIZCTEOSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |