C27H23NO3 — CID 164676216
3-methylbut-3-enyl (10bR,11R)-6-oxo-10b-phenyl-11H-isoindolo[2,1-a]indole-11-carboxylate (PubChem CID 164676216) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-methylbut-3-enyl (10bR,11R)-6-oxo-10b-phenyl-11H-isoindolo[2,1-a]indole-11-carboxylate.
| Compound Name | 3-methylbut-3-enyl (10bR,11R)-6-oxo-10b-phenyl-11H-isoindolo[2,1-a]indole-11-carboxylate |
|---|---|
| PubChem CID | 164676216 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-methylbut-3-enyl (10bR,11R)-6-oxo-10b-phenyl-11H-isoindolo[2,1-a]indole-11-carboxylate |
| SMILES | C=C(C)CCOC(=O)[C@@H]1c2ccccc2N2C(=O)c3ccccc3[C@]12c1ccccc1 |
| InChI | InChI=1S/C27H23NO3/c1-18(2)16-17-31-26(30)24-21-13-7-9-15-23(21)28-25(29)20-12-6-8-14-22(20)27(24,28)19-10-4-3-5-11-19/h3-15,24H,1,16-17H2,2H3/t24-,27+/m0/s1 |
| InChIKey | VNPDZRWHWLSIOT-RPLLCQBOSA-N |
| XLogP | 5.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|