C24H20ClNO4S — CID 164677287
methyl 4-[3-(4-chloro-N-(4-methylphenyl)sulfonylanilino)prop-1-ynyl]benzoate (PubChem CID 164677287) has the molecular formula C24H20ClNO4S and a molecular weight of 453.95 g/mol. Its IUPAC name is methyl 4-[3-(4-chloro-N-(4-methylphenyl)sulfonylanilino)prop-1-ynyl]benzoate.
| Compound Name | methyl 4-[3-(4-chloro-N-(4-methylphenyl)sulfonylanilino)prop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 164677287 |
| Molecular Formula | C24H20ClNO4S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | methyl 4-[3-(4-chloro-N-(4-methylphenyl)sulfonylanilino)prop-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#CCN(c2ccc(Cl)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H20ClNO4S/c1-18-5-15-23(16-6-18)31(28,29)26(22-13-11-21(25)12-14-22)17-3-4-19-7-9-20(10-8-19)24(27)30-2/h5-16H,17H2,1-2H3 |
| InChIKey | HGJOZGLFLPMURT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|