C42H44O5 — CID 164677520
diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(4-phenylphenyl)methyl]propanedioate (PubChem CID 164677520) has the molecular formula C42H44O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(4-phenylphenyl)methyl]propanedioate.
| Compound Name | diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(4-phenylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 164677520 |
| Molecular Formula | C42H44O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(4-phenylphenyl)methyl]propanedioate |
| SMILES | CC(C)(C)C1=CC(C(c2ccc(-c3ccccc3)cc2)C(C(=O)Oc2ccccc2)C(=O)Oc2ccccc2)C=C(C(C)(C)C)C1O |
| InChI | InChI=1S/C42H44O5/c1-41(2,3)34-26-31(27-35(38(34)43)42(4,5)6)36(30-24-22-29(23-25-30)28-16-10-7-11-17-28)37(39(44)46-32-18-12-8-13-19-32)40(45)47-33-20-14-9-15-21-33/h7-27,31,36-38,43H,1-6H3 |
| InChIKey | AZSQXOZJIVCVKU-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|