C37H39F3O5 — CID 164679719
diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-[4-(trifluoromethyl)phenyl]methyl]propanedioate (PubChem CID 164679719) has the molecular formula C37H39F3O5 and a molecular weight of 620.71 g/mol. Its IUPAC name is diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-[4-(trifluoromethyl)phenyl]methyl]propanedioate.
| Compound Name | diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-[4-(trifluoromethyl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 164679719 |
| Molecular Formula | C37H39F3O5 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-[4-(trifluoromethyl)phenyl]methyl]propanedioate |
| SMILES | CC(C)(C)C1=CC(C(c2ccc(C(F)(F)F)cc2)C(C(=O)Oc2ccccc2)C(=O)Oc2ccccc2)C=C(C(C)(C)C)C1O |
| InChI | InChI=1S/C37H39F3O5/c1-35(2,3)28-21-24(22-29(32(28)41)36(4,5)6)30(23-17-19-25(20-18-23)37(38,39)40)31(33(42)44-26-13-9-7-10-14-26)34(43)45-27-15-11-8-12-16-27/h7-22,24,30-32,41H,1-6H3 |
| InChIKey | JDOWGNDVQBJMMX-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|