C43H46O6 — CID 164677521
diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(3-phenylmethoxyphenyl)methyl]propanedioate (PubChem CID 164677521) has the molecular formula C43H46O6 and a molecular weight of 658.84 g/mol. Its IUPAC name is diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(3-phenylmethoxyphenyl)methyl]propanedioate.
| Compound Name | diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(3-phenylmethoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 164677521 |
| Molecular Formula | C43H46O6 |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | diphenyl 2-[(R)-(3,5-ditert-butyl-4-hydroxycyclohexa-2,5-dien-1-yl)-(3-phenylmethoxyphenyl)methyl]propanedioate |
| SMILES | CC(C)(C)C1=CC(C(c2cccc(OCc3ccccc3)c2)C(C(=O)Oc2ccccc2)C(=O)Oc2ccccc2)C=C(C(C)(C)C)C1O |
| InChI | InChI=1S/C43H46O6/c1-42(2,3)35-26-31(27-36(39(35)44)43(4,5)6)37(30-19-16-24-34(25-30)47-28-29-17-10-7-11-18-29)38(40(45)48-32-20-12-8-13-21-32)41(46)49-33-22-14-9-15-23-33/h7-27,31,37-39,44H,28H2,1-6H3 |
| InChIKey | OKQLXSZMOANJLZ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|